Difference between revisions of "4.1.99.4-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2189 == * common-name: ** 4-hydroxy-l-threonine * inchi-key: ** jbnuarfqocgdrk-gbxijsldsa-n * molecular-weight: ** 135.119 * smiles:...") |
(Created page with "Category:metabolite == Metabolite REDUCED-MENAQUINONE == * common-name: ** menaquinol-8 * inchi-key: ** oiezrvbfvpgodt-wqwycsgdsa-n * molecular-weight: ** 719.144 * smiles...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite REDUCED-MENAQUINONE == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-8 |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** oiezrvbfvpgodt-wqwycsgdsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 719.144 |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(/c(\c(\o)=1)=c/c=cc=2))/o) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[biomass]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-8}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=719.144}} |
Revision as of 07:48, 5 October 2020
Contents
Metabolite REDUCED-MENAQUINONE
- common-name:
- menaquinol-8
- inchi-key:
- oiezrvbfvpgodt-wqwycsgdsa-n
- molecular-weight:
- 719.144
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(/c(\c(\o)=1)=c/c=cc=2))/o)
