Difference between revisions of "4.1.99.4-RXN"

Revision as of 07:03, 9 October 2020

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite REDUCED-MENAQUINONE ==
+== Metabolite ERYTHROSE-4P ==
 * common-name:
-** menaquinol-8
+** d-erythrose 4-phosphate
 * inchi-key:
-** oiezrvbfvpgodt-wqwycsgdsa-n
+** nghmdnpxvrffgs-iuyqgcfvsa-l
 * molecular-weight:
-** 719.144
+** 198.069
 * smiles:
-** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(/c(\c(\o)=1)=c/c=cc=2))/o)
+** [ch]([c@@h]([c@@h](cop([o-])([o-])=o)o)o)=o
 == Reaction(s) known to consume the compound ==
-* [[biomass]]
+* [[2TRANSKETO-RXN]]
+* [[DAHPSYN-RXN]]
+* [[ERYTH4PDEHYDROG-RXN]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRANSALDOL-RXN]]
 == Reaction(s) known to produce the compound ==
-* [[ADOMET-DMK-METHYLTRANSFER-RXN]]
+* [[2TRANSKETO-RXN]]
+* [[DAHPSYN-RXN]]
+* [[SEDOBISALDOL-RXN]]
+* [[TRANSALDOL-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=menaquinol-8}}
+{{#set: common-name=d-erythrose 4-phosphate}}
-{{#set: inchi-key=inchikey=oiezrvbfvpgodt-wqwycsgdsa-n}}
+{{#set: inchi-key=inchikey=nghmdnpxvrffgs-iuyqgcfvsa-l}}
-{{#set: molecular-weight=719.144}}
+{{#set: molecular-weight=198.069}}