Difference between revisions of "RXN-16380"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-L-lysine == * common-name: ** a [protein]-l-lysine == Reaction(s) known to consume the compound == * 2.3.2.13-RXN == Reaction...") |
(Created page with "Category:metabolite == Metabolite CPD-1136 == * common-name: ** cis-2-methylaconitate * inchi-key: ** nuzlrkbhobptqv-arjawskdsa-k * molecular-weight: ** 185.113 * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-1136 == |
* common-name: | * common-name: | ||
| − | ** | + | ** cis-2-methylaconitate |
| + | * inchi-key: | ||
| + | ** nuzlrkbhobptqv-arjawskdsa-k | ||
| + | * molecular-weight: | ||
| + | ** 185.113 | ||
| + | * smiles: | ||
| + | ** cc(/c([o-])=o)=c(cc([o-])=o)/c([o-])=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2 | + | * [[2-METHYLCITRATE-DEHYDRATASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2-METHYLCITRATE-DEHYDRATASE-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=cis-2-methylaconitate}} |
| + | {{#set: inchi-key=inchikey=nuzlrkbhobptqv-arjawskdsa-k}} | ||
| + | {{#set: molecular-weight=185.113}} | ||
Revision as of 17:44, 3 November 2020
Contents
Metabolite CPD-1136
- common-name:
- cis-2-methylaconitate
- inchi-key:
- nuzlrkbhobptqv-arjawskdsa-k
- molecular-weight:
- 185.113
- smiles:
- cc(/c([o-])=o)=c(cc([o-])=o)/c([o-])=o
