Difference between revisions of "RXN0-383"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-2-methyladenine2503 == * common-name: ** a 2-methyladenine2503 in 23s rrna == Reaction(s) known to consume the compound == == Re...")
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 23S-rRNA-2-methyladenine2503 ==
+
== Metabolite 2-ACETO-LACTATE ==
 
* common-name:
 
* common-name:
** a 2-methyladenine2503 in 23s rrna
+
** (s)-2-acetolactate
 +
* inchi-key:
 +
** nmdwgegfjubklb-yfkpbyrvsa-m
 +
* molecular-weight:
 +
** 131.108
 +
* smiles:
 +
** cc(=o)[c@](c)(o)c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[RXN-6081]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11586]]
+
* [[ACETOLACTSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 2-methyladenine2503 in 23s rrna}}
+
{{#set: common-name=(s)-2-acetolactate}}
 +
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
 +
{{#set: molecular-weight=131.108}}

Revision as of 17:48, 3 November 2020

Metabolite 2-ACETO-LACTATE

  • common-name:
    • (s)-2-acetolactate
  • inchi-key:
    • nmdwgegfjubklb-yfkpbyrvsa-m
  • molecular-weight:
    • 131.108
  • smiles:
    • cc(=o)[c@](c)(o)c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality