Difference between revisions of "RXN0-383"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 23S-rRNA-2-methyladenine2503 == * common-name: ** a 2-methyladenine2503 in 23s rrna == Reaction(s) known to consume the compound == == Re...") |
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-ACETO-LACTATE == |
* common-name: | * common-name: | ||
− | ** | + | ** (s)-2-acetolactate |
+ | * inchi-key: | ||
+ | ** nmdwgegfjubklb-yfkpbyrvsa-m | ||
+ | * molecular-weight: | ||
+ | ** 131.108 | ||
+ | * smiles: | ||
+ | ** cc(=o)[c@](c)(o)c(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[ACETOLACTREDUCTOISOM-RXN]] | ||
+ | * [[RXN-6081]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[ACETOLACTSYN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(s)-2-acetolactate}} |
+ | {{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}} | ||
+ | {{#set: molecular-weight=131.108}} |
Revision as of 17:48, 3 November 2020
Contents
Metabolite 2-ACETO-LACTATE
- common-name:
- (s)-2-acetolactate
- inchi-key:
- nmdwgegfjubklb-yfkpbyrvsa-m
- molecular-weight:
- 131.108
- smiles:
- cc(=o)[c@](c)(o)c(=o)[o-]