Difference between revisions of "MALTOHEXAOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-20903 == * common-name: ** cob(ii)inamide * inchi-key: ** gfvwzogcskvpra-jfyqdrlcsa-m * molecular-weight: ** 990.096 * smiles: ** c[c...")
(Created page with "Category:metabolite == Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE == * common-name: ** (5z,8z,11z,14z,17z)-icosapentaenoate * inchi-key: ** jazbehyotptenj-jlnkqsitsa-m * m...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-20903 ==
+
== Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE ==
 
* common-name:
 
* common-name:
** cob(ii)inamide
+
** (5z,8z,11z,14z,17z)-icosapentaenoate
 
* inchi-key:
 
* inchi-key:
** gfvwzogcskvpra-jfyqdrlcsa-m
+
** jazbehyotptenj-jlnkqsitsa-m
 
* molecular-weight:
 
* molecular-weight:
** 990.096
+
** 301.448
 
* smiles:
 
* smiles:
** c[c@@h](o)cnc(=o)cc[c@]2(c)([c@@h](cc(=o)n)[c@h]4([c@@]8(c)([c@@](c)(cc(n)=o)[c@h](ccc(n)=o)c7(=[n+]([co--]35([n+]1(c(\c(c)(c)[c@h](ccc(n)=o)c=1c(\c)=c2/n34)=c/c6([c@@h](ccc(n)=o)[c@](c)(cc(n)=o)c(/[n+]5=6)=c(c)/7))))8))))
+
** ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ExchangeSeed-CPD-20903]]
+
* [[RXN-12978]]
* [[RXN-19342]]
 
* [[TransportSeed-CPD-20903]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ExchangeSeed-CPD-20903]]
 
* [[TransportSeed-CPD-20903]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cob(ii)inamide}}
+
{{#set: common-name=(5z,8z,11z,14z,17z)-icosapentaenoate}}
{{#set: inchi-key=inchikey=gfvwzogcskvpra-jfyqdrlcsa-m}}
+
{{#set: inchi-key=inchikey=jazbehyotptenj-jlnkqsitsa-m}}
{{#set: molecular-weight=990.096}}
+
{{#set: molecular-weight=301.448}}

Revision as of 18:57, 13 January 2021

Metabolite 5Z8Z11Z14Z17Z-EICOSAPENTAENOATE

  • common-name:
    • (5z,8z,11z,14z,17z)-icosapentaenoate
  • inchi-key:
    • jazbehyotptenj-jlnkqsitsa-m
  • molecular-weight:
    • 301.448
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality