Difference between revisions of "RXN-16380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-1136 == * common-name: ** cis-2-methylaconitate * inchi-key: ** nuzlrkbhobptqv-arjawskdsa-k * molecular-weight: ** 185.113 * smiles:...")
(Created page with "Category:metabolite == Metabolite SAMP-C-Terminal-Glycine == * common-name: ** a [samp] c-terminal glycine == Reaction(s) known to consume the compound == == Reaction(s) k...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-1136 ==
+
== Metabolite SAMP-C-Terminal-Glycine ==
 
* common-name:
 
* common-name:
** cis-2-methylaconitate
+
** a [samp] c-terminal glycine
* inchi-key:
 
** nuzlrkbhobptqv-arjawskdsa-k
 
* molecular-weight:
 
** 185.113
 
* smiles:
 
** cc(/c([o-])=o)=c(cc([o-])=o)/c([o-])=o
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-METHYLCITRATE-DEHYDRATASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-METHYLCITRATE-DEHYDRATASE-RXN]]
+
* [[RXN-18693]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=cis-2-methylaconitate}}
+
{{#set: common-name=a [samp] c-terminal glycine}}
{{#set: inchi-key=inchikey=nuzlrkbhobptqv-arjawskdsa-k}}
 
{{#set: molecular-weight=185.113}}
 

Revision as of 19:00, 13 January 2021

Metabolite SAMP-C-Terminal-Glycine

  • common-name:
    • a [samp] c-terminal glycine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [samp] c-terminal glycine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.