Difference between revisions of "6.3.1.4-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19490 == * common-name: ** 3-carboxy-7-(methylsulfanyl)-2-oxoheptanoate * inchi-key: ** xxjzwlkrfpcklb-uhfffaoysa-l * molecular-weigh...")
(Created page with "Category:metabolite == Metabolite N-Acetyl-beta-D-Hexosaminides == * common-name: ** an n-acetyl-β-d-hexosaminide == Reaction(s) known to consume the compound == * ...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19490 ==
+
== Metabolite N-Acetyl-beta-D-Hexosaminides ==
 
* common-name:
 
* common-name:
** 3-carboxy-7-(methylsulfanyl)-2-oxoheptanoate
+
** an n-acetyl-β-d-hexosaminide
* inchi-key:
 
** xxjzwlkrfpcklb-uhfffaoysa-l
 
* molecular-weight:
 
** 232.251
 
* smiles:
 
** csccccc(c(=o)c(=o)[o-])c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-18206]]
+
* [[3.2.1.52-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-18206]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-carboxy-7-(methylsulfanyl)-2-oxoheptanoate}}
+
{{#set: common-name=an n-acetyl-β-d-hexosaminide}}
{{#set: inchi-key=inchikey=xxjzwlkrfpcklb-uhfffaoysa-l}}
 
{{#set: molecular-weight=232.251}}
 

Revision as of 19:01, 13 January 2021

Metabolite N-Acetyl-beta-D-Hexosaminides

  • common-name:
    • an n-acetyl-β-d-hexosaminide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality