Difference between revisions of "2.6.1.70-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite O-SUCCINYLBENZOATE == * common-name: ** 2-succinylbenzoate * inchi-key: ** yivwqnvqrxfzjb-uhfffaoysa-l * molecular-weight: ** 220.181 * s...") |
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * inchi-key: ** ocymerzcmyjqqo-uhfffaoysa-l * molecular-weight: ** 221....") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite THZ-P == |
* common-name: | * common-name: | ||
− | ** 2- | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ocymerzcmyjqqo-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 221.167 |
* smiles: | * smiles: | ||
− | ** | + | ** cc1(/n=csc(\ccop([o-])(=o)[o-])=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[THI-P-SYN-RXN]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXNQT-4301]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2- | + | {{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=221.167}} |
Revision as of 19:02, 13 January 2021
Contents
Metabolite THZ-P
- common-name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- inchi-key:
- ocymerzcmyjqqo-uhfffaoysa-l
- molecular-weight:
- 221.167
- smiles:
- cc1(/n=csc(\ccop([o-])(=o)[o-])=1)