Difference between revisions of "RXN0-383"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...")
(Created page with "Category:metabolite == Metabolite CPD-2343 == * common-name: ** 3-keto-l-gulonate 6-phosphate * inchi-key: ** bduiikxsxfdpec-lwkdlahasa-k * molecular-weight: ** 271.097 *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ACETO-LACTATE ==
+
== Metabolite CPD-2343 ==
 
* common-name:
 
* common-name:
** (s)-2-acetolactate
+
** 3-keto-l-gulonate 6-phosphate
 
* inchi-key:
 
* inchi-key:
** nmdwgegfjubklb-yfkpbyrvsa-m
+
** bduiikxsxfdpec-lwkdlahasa-k
 
* molecular-weight:
 
* molecular-weight:
** 131.108
+
** 271.097
 
* smiles:
 
* smiles:
** cc(=o)[c@](c)(o)c(=o)[o-]
+
** c(op([o-])([o-])=o)[c@h](o)[c@h](c([c@@h](c([o-])=o)o)=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETOLACTREDUCTOISOM-RXN]]
 
* [[RXN-6081]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTSYN-RXN]]
+
* [[RXN0-5214]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2-acetolactate}}
+
{{#set: common-name=3-keto-l-gulonate 6-phosphate}}
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
+
{{#set: inchi-key=inchikey=bduiikxsxfdpec-lwkdlahasa-k}}
{{#set: molecular-weight=131.108}}
+
{{#set: molecular-weight=271.097}}

Revision as of 19:03, 13 January 2021

Metabolite CPD-2343

  • common-name:
    • 3-keto-l-gulonate 6-phosphate
  • inchi-key:
    • bduiikxsxfdpec-lwkdlahasa-k
  • molecular-weight:
    • 271.097
  • smiles:
    • c(op([o-])([o-])=o)[c@h](o)[c@h](c([c@@h](c([o-])=o)o)=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality