Difference between revisions of "CPD-12443"

Revision as of 19:28, 13 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite 2-OCTAPRENYL-6-METHOXYPHENOL ==
+== Metabolite 16S-rRNA-guanine-527 ==
 * common-name:
-** 2-methoxy-6-(all-trans-octaprenyl)phenol
+** a guanine527 in 16s rrna
-* inchi-key:
-** margkpimnmaskj-cmaxttdksa-n
-* molecular-weight:
-** 669.085
-* smiles:
-** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c=cc=1)/oc)
 == Reaction(s) known to consume the compound ==
-* [[2-OCTAPRENYL-6-METHOXYPHENOL-HYDROX-RXN]]
+* [[RXN-11578]]
 == Reaction(s) known to produce the compound ==
-* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=2-methoxy-6-(all-trans-octaprenyl)phenol}}
+{{#set: common-name=a guanine527 in 16s rrna}}
-{{#set: inchi-key=inchikey=margkpimnmaskj-cmaxttdksa-n}}
-{{#set: molecular-weight=669.085}}