Difference between revisions of "DADPKIN-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9956 == * common-name: ** ubiquinol-8 * inchi-key: ** lojuqfspyhmheo-sghxuwjisa-n * molecular-weight: ** 729.137 * smiles: ** cc(c)=c...") |
(Created page with "Category:metabolite == Metabolite CPD-536 == * common-name: ** glycerol 2-phosphate * inchi-key: ** dhclvcxqibboph-uhfffaoysa-l * molecular-weight: ** 170.058 * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-536 == |
* common-name: | * common-name: | ||
| − | ** | + | ** glycerol 2-phosphate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** dhclvcxqibboph-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 170.058 |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c(co)op([o-])([o-])=o)o |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[GLYCEROL-2-PHOSPHATASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=glycerol 2-phosphate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=dhclvcxqibboph-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=170.058}} |
Revision as of 19:30, 13 January 2021
Contents
Metabolite CPD-536
- common-name:
- glycerol 2-phosphate
- inchi-key:
- dhclvcxqibboph-uhfffaoysa-l
- molecular-weight:
- 170.058
- smiles:
- c(c(co)op([o-])([o-])=o)o
