Difference between revisions of "2-HALOACID-DEHALOGENASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13418 == * common-name: ** xxfg xyloglucan oligosaccharide * inchi-key: ** ikymupzuajozhc-ndkuyqllsa-n * molecular-weight: ** 1371.21...")
(Created page with "Category:metabolite == Metabolite 4-IMIDAZOLONE-5-PROPIONATE == * common-name: ** 4-imidazolone-5-propanoate * inchi-key: ** hexmlhkqvufyme-uhfffaoysa-m * molecular-weight...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-13418 ==
+
== Metabolite 4-IMIDAZOLONE-5-PROPIONATE ==
 
* common-name:
 
* common-name:
** xxfg xyloglucan oligosaccharide
+
** 4-imidazolone-5-propanoate
 
* inchi-key:
 
* inchi-key:
** ikymupzuajozhc-ndkuyqllsa-n
+
** hexmlhkqvufyme-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 1371.215
+
** 155.133
 
* smiles:
 
* smiles:
** c[c@@h]9(o[c@@h](o[c@h]8([c@h]([c@h]([c@h](o[c@@h](oc7(c(oc[c@@h]6(o[c@@h](o[c@@h]1([c@h](o)[c@@h](o)[c@h](o)o[c@h](co)1))[c@h](o)[c@@h](o)[c@h](o[c@h]5(o[c@h](coc2(c([c@h](c(co2)o)o)o))[c@@h](o[c@h]4(o[c@h](coc3(c([c@h](c(co3)o)o)o))[c@@h](o)[c@h](o)[c@@h](o)4))[c@h](o)[c@@h](o)5))6))occ([c@@h]7o)o))8)co)o)o))[c@@h]([c@h]([c@h]9o)o)o)
+
** c(c1(c(=o)n=cn1))cc(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-19378]]
+
* [[IMIDAZOLONEPROPIONASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[UROCANATE-HYDRATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=xxfg xyloglucan oligosaccharide}}
+
{{#set: common-name=4-imidazolone-5-propanoate}}
{{#set: inchi-key=inchikey=ikymupzuajozhc-ndkuyqllsa-n}}
+
{{#set: inchi-key=inchikey=hexmlhkqvufyme-uhfffaoysa-m}}
{{#set: molecular-weight=1371.215}}
+
{{#set: molecular-weight=155.133}}

Revision as of 19:31, 13 January 2021

Metabolite 4-IMIDAZOLONE-5-PROPIONATE

  • common-name:
    • 4-imidazolone-5-propanoate
  • inchi-key:
    • hexmlhkqvufyme-uhfffaoysa-m
  • molecular-weight:
    • 155.133
  • smiles:
    • c(c1(c(=o)n=cn1))cc(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality