Difference between revisions of "1.2.7.8-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...")
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-vaccenoyl-ACPs == * common-name: ** an (11z)-3-oxooctadec-11-enoyl-[acp] == Reaction(s) known to consume the compound == * RX...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-ACETO-LACTATE ==
+
== Metabolite 3-oxo-cis-vaccenoyl-ACPs ==
 
* common-name:
 
* common-name:
** (s)-2-acetolactate
+
** an (11z)-3-oxooctadec-11-enoyl-[acp]
* inchi-key:
 
** nmdwgegfjubklb-yfkpbyrvsa-m
 
* molecular-weight:
 
** 131.108
 
* smiles:
 
** cc(=o)[c@](c)(o)c(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACETOLACTREDUCTOISOM-RXN]]
+
* [[RXN-9556]]
* [[RXN-6081]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACETOLACTSYN-RXN]]
+
* [[2.3.1.179-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-2-acetolactate}}
+
{{#set: common-name=an (11z)-3-oxooctadec-11-enoyl-[acp]}}
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
 
{{#set: molecular-weight=131.108}}
 

Revision as of 19:34, 13 January 2021

Metabolite 3-oxo-cis-vaccenoyl-ACPs

  • common-name:
    • an (11z)-3-oxooctadec-11-enoyl-[acp]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an (11z)-3-oxooctadec-11-enoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.