Difference between revisions of "DADPKIN-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-536 == * common-name: ** glycerol 2-phosphate * inchi-key: ** dhclvcxqibboph-uhfffaoysa-l * molecular-weight: ** 170.058 * smiles: **...")
(Created page with "Category:metabolite == Metabolite OH-MYRISTOYL == * common-name: ** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine * inchi-key: ** kojcfmystwnmqw-ruajd...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-536 ==
+
== Metabolite OH-MYRISTOYL ==
 
* common-name:
 
* common-name:
** glycerol 2-phosphate
+
** udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine
 
* inchi-key:
 
* inchi-key:
** dhclvcxqibboph-uhfffaoysa-l
+
** kojcfmystwnmqw-ruajdyctsa-l
 
* molecular-weight:
 
* molecular-weight:
** 170.058
+
** 1016.021
 
* smiles:
 
* smiles:
** c(c(co)op([o-])([o-])=o)o
+
** ccccccccccc[c@h](cc(n[c@h]1([c@h]([c@@h]([c@h](o[c@@h]1op(=o)([o-])op(=o)([o-])oc[c@@h]2(o[c@h]([c@h](o)[c@h](o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(c[c@@h](ccccccccccc)o)=o))=o)o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYCEROL-2-PHOSPHATASE-RXN]]
+
* [[LIPIDADISACCHARIDESYNTH-RXN]]
 +
* [[LIPIDXSYNTHESIS-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[UDPHYDROXYMYRGLUCOSAMNACETYLTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=glycerol 2-phosphate}}
+
{{#set: common-name=udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine}}
{{#set: inchi-key=inchikey=dhclvcxqibboph-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=kojcfmystwnmqw-ruajdyctsa-l}}
{{#set: molecular-weight=170.058}}
+
{{#set: molecular-weight=1016.021}}

Revision as of 11:53, 15 January 2021

Metabolite OH-MYRISTOYL

  • common-name:
    • udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine
  • inchi-key:
    • kojcfmystwnmqw-ruajdyctsa-l
  • molecular-weight:
    • 1016.021
  • smiles:
    • ccccccccccc[c@h](cc(n[c@h]1([c@h]([c@@h]([c@h](o[c@@h]1op(=o)([o-])op(=o)([o-])oc[c@@h]2(o[c@h]([c@h](o)[c@h](o)2)n3(c=cc(=o)nc(=o)3)))co)o)oc(c[c@@h](ccccccccccc)o)=o))=o)o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "udp-2-n,3-o-bis[(3r)-3-hydroxytetradecanoyl]-α-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.