Difference between revisions of "2-OXOGLUTARATE-SYNTHASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9245 == * common-name: ** palmitoleate * inchi-key: ** secpzkhbenqxjg-fplpwbnlsa-m * molecular-weight: ** 253.404 * smiles: ** cccccc...")
(Created page with "Category:metabolite == Metabolite Ribonuc-tri-P-reductases-inactive == * common-name: ** an inactive ribonucleoside triphosphate reductase == Reaction(s) known to consume...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9245 ==
+
== Metabolite Ribonuc-tri-P-reductases-inactive ==
 
* common-name:
 
* common-name:
** palmitoleate
+
** an inactive ribonucleoside triphosphate reductase
* inchi-key:
 
** secpzkhbenqxjg-fplpwbnlsa-m
 
* molecular-weight:
 
** 253.404
 
* smiles:
 
** ccccccc=ccccccccc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-7248]]
+
* [[RNTRACTIV-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=palmitoleate}}
+
{{#set: common-name=an inactive ribonucleoside triphosphate reductase}}
{{#set: inchi-key=inchikey=secpzkhbenqxjg-fplpwbnlsa-m}}
 
{{#set: molecular-weight=253.404}}
 

Revision as of 15:54, 18 March 2021

Metabolite Ribonuc-tri-P-reductases-inactive

  • common-name:
    • an inactive ribonucleoside triphosphate reductase

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality