Difference between revisions of "ADENOSINE-NUCLEOSIDASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-PYRUVATE == * common-name: ** imidazole-pyruvate * inchi-key: ** jejnwereqwmohb-uhfffaoysa-m * molecular-weight: ** 153.117 * s...")
(Created page with "Category:metabolite == Metabolite DIHYDROXY-BUTANONE-P == * common-name: ** 1-deoxy-l-glycero-tetrulose 4-phosphate * inchi-key: ** okyhyxlctggolm-scsaibsysa-l * molecular...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMIDAZOLE-PYRUVATE ==
+
== Metabolite DIHYDROXY-BUTANONE-P ==
 
* common-name:
 
* common-name:
** imidazole-pyruvate
+
** 1-deoxy-l-glycero-tetrulose 4-phosphate
 
* inchi-key:
 
* inchi-key:
** jejnwereqwmohb-uhfffaoysa-m
+
** okyhyxlctggolm-scsaibsysa-l
 
* molecular-weight:
 
* molecular-weight:
** 153.117
+
** 182.069
 
* smiles:
 
* smiles:
** c1(/nc=nc(\cc(=o)c(=o)[o-])=1)
+
** cc(=o)[c@h](o)cop(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7571]]
+
* [[LUMAZINESYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7571]]
+
* [[DIOHBUTANONEPSYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imidazole-pyruvate}}
+
{{#set: common-name=1-deoxy-l-glycero-tetrulose 4-phosphate}}
{{#set: inchi-key=inchikey=jejnwereqwmohb-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=okyhyxlctggolm-scsaibsysa-l}}
{{#set: molecular-weight=153.117}}
+
{{#set: molecular-weight=182.069}}

Revision as of 15:56, 18 March 2021

Metabolite DIHYDROXY-BUTANONE-P

  • common-name:
    • 1-deoxy-l-glycero-tetrulose 4-phosphate
  • inchi-key:
    • okyhyxlctggolm-scsaibsysa-l
  • molecular-weight:
    • 182.069
  • smiles:
    • cc(=o)[c@h](o)cop(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality