Difference between revisions of "RXN-10658"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * inchi-key: ** ufzdimbxtvrbds-ssqlmynasa-n * molecular-weight: ** 636.999 * smiles:...")
(Created page with "Category:metabolite == Metabolite 16S-rRNA-N3-methyluracil1498 == * common-name: ** an n3-methyluracil1498 in 16s rrna == Reaction(s) known to consume the compound == == R...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12117 ==
+
== Metabolite 16S-rRNA-N3-methyluracil1498 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-7
+
** an n3-methyluracil1498 in 16s rrna
* inchi-key:
 
** ufzdimbxtvrbds-ssqlmynasa-n
 
* molecular-weight:
 
** 636.999
 
* smiles:
 
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(o)c2(\c=cc=cc(/c(\o)=1)=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9191]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9190]]
+
* [[RXN-11598]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-7}}
+
{{#set: common-name=an n3-methyluracil1498 in 16s rrna}}
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
 
{{#set: molecular-weight=636.999}}
 

Revision as of 15:57, 18 March 2021

Metabolite 16S-rRNA-N3-methyluracil1498

  • common-name:
    • an n3-methyluracil1498 in 16s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality