Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FSU_RS02840 == * common-name: ** prob * transcription-direction: ** negative * centisome-position: ** 17.406227 * left-end-position: ** 668922 *...")
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FSU_RS02840 ==
+
== Metabolite 4-hydroxybenzoate ==
 
* common-name:
 
* common-name:
−
** prob
+
** 4-hydroxybenzoate
−
* transcription-direction:
+
* inchi-key:
−
** negative
+
** fjkrolugyxjwqn-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 17.406227   
+
** 137.115
−
* left-end-position:
+
* smiles:
−
** 668922
+
** c(c1(/c=cc(\o)=c/c=1))(=o)[o-]
−
* right-end-position:
+
== Reaction(s) known to consume the compound ==
−
** 670061
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to produce the compound ==
−
* [[fibrobacter_18032021]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) associated ==
+
{{#set: common-name=4-hydroxybenzoate}}
−
* [[GLUTKIN-RXN]]
+
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=137.115}}
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[faecalibacterium]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[plantarum]]; tool: [[orthofinder]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[CITRULBIO-PWY]]
 
−
** '''8''' reactions found over '''8''' reactions in the full pathway
 
−
* [[ARGININE-SYN4-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-6922]]
 
−
** '''7''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-3341]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PROSYN-PWY]]
 
−
** '''4''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: common-name=prob}}
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: centisome-position=17.406227    }}
 
−
{{#set: left-end-position=668922}}
 
−
{{#set: right-end-position=670061}}
 
−
{{#set: organism associated=fibrobacter_18032021}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=5}}
 

Revision as of 17:59, 26 April 2021

Metabolite 4-hydroxybenzoate

  • common-name:
    • 4-hydroxybenzoate
  • inchi-key:
    • fjkrolugyxjwqn-uhfffaoysa-m
  • molecular-weight:
    • 137.115
  • smiles:
    • c(c1(/c=cc(\o)=c/c=1))(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=4-hydroxybenzoate&oldid=74270"