Difference between revisions of "MALONYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-oxo-cis-D7-tetradecenoyl-ACPs == * common-name: ** a (7z)-3-oxotetradec-7-enoyl-[acp] == Reaction(s) known to consume the compound == *...") |
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * inchi-key: ** wbfyvdchgvnrbh-uhfffaoysa-m * molecular-weight: ** 313.295 *...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-8-DIHYDROPTEROATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 7,8-dihydropteroate |
| + | * inchi-key: | ||
| + | ** wbfyvdchgvnrbh-uhfffaoysa-m | ||
| + | * molecular-weight: | ||
| + | ** 313.295 | ||
| + | * smiles: | ||
| + | ** c(nc1(/c=cc(\c(=o)[o-])=c/c=1))c2(cnc3(\n=c(n)nc(=o)c(\n=2)=3)) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[DIHYDROFOLATESYNTH-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[H2PTEROATESYNTH-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=7,8-dihydropteroate}} |
| + | {{#set: inchi-key=inchikey=wbfyvdchgvnrbh-uhfffaoysa-m}} | ||
| + | {{#set: molecular-weight=313.295}} | ||
Revision as of 18:02, 26 April 2021
Contents
Metabolite 7-8-DIHYDROPTEROATE
- common-name:
- 7,8-dihydropteroate
- inchi-key:
- wbfyvdchgvnrbh-uhfffaoysa-m
- molecular-weight:
- 313.295
- smiles:
- c(nc1(/c=cc(\c(=o)[o-])=c/c=1))c2(cnc3(\n=c(n)nc(=o)c(\n=2)=3))
