Difference between revisions of "ExchangeSeed-ATP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * inchi-key: ** meymblgokydglz-uhfffaoysa-o * molecular-weight: ** 180.189 * smil...")
(Created page with "Category:reaction == Reaction 1.5.1.9-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/1.5.1.9 ec-1.5.1.9] * direction: ** left-to-right == Reaction formula == * 1 NA...")
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE ==
+
== Reaction 1.5.1.9-RXN ==
* common-name:
+
* ec-number:
** preq1
+
** [http://enzyme.expasy.org/EC/1.5.1.9 ec-1.5.1.9]
* inchi-key:
+
* direction:
** meymblgokydglz-uhfffaoysa-o
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 180.189
+
* 1 [[NAD]][c] '''+''' 1 [[SACCHAROPINE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[ALLYSINE]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c([n+])c1(/c2(/c(=o)nc(n)=nc(\nc=1)=2))
+
* Gene: [[FSU_RS04380]]
== Reaction(s) known to consume the compound ==
+
** Category: [[manual]]
* [[RXN0-1321]]
+
*** Source: [[reactions_add_147_emile_annot]], Tool: [[unknown-tool]], Assignment: n.a, Comment: added from the nc_017448.1 f. succinogenes s85 genome scale metabolic model.
== Reaction(s) known to produce the compound ==
+
== Pathway(s) ==
* [[RXN0-4022]]
+
* [[LYSINE-DEG1-PWY]], L-lysine degradation XI (mammalian):
== Reaction(s) of unknown directionality ==
+
** '''2''' reactions found over '''5''' reactions in the full pathway
{{#set: common-name=preq1}}
+
== Reconstruction information  ==
{{#set: inchi-key=inchikey=meymblgokydglz-uhfffaoysa-o}}
+
* category: [[manual]]; source: [[reactions_add_147_emile_annot]]; tool: [[curation]]; comment: added from the nc_017448.1 f. succinogenes s85 genome scale metabolic model.
{{#set: molecular-weight=180.189}}
+
== External links  ==
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24521 24521]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R02313 R02313]
 +
{{#set: ec-number=ec-1.5.1.9}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=1}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=added from the nc_017448.1 f. succinogenes s85 genome scale metabolic model.}}
 +
{{#set: reconstruction source=reactions_add_147_emile_annot}}

Revision as of 18:04, 26 April 2021

Reaction 1.5.1.9-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • LYSINE-DEG1-PWY, L-lysine degradation XI (mammalian):
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links