Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...")
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * RXN-12448 == Reaction(s) known to p...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 4-hydroxybenzoate ==
+
== Metabolite LONG-CHAIN-KETONE ==
 
* common-name:
 
* common-name:
** 4-hydroxybenzoate
+
** a ketone
* inchi-key:
 
** fjkrolugyxjwqn-uhfffaoysa-m
 
* molecular-weight:
 
** 137.115
 
* smiles:
 
** c(c1(/c=cc(\o)=c/c=1))(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
+
* [[RXN-12448]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12448]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=4-hydroxybenzoate}}
+
{{#set: common-name=a ketone}}
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
 
{{#set: molecular-weight=137.115}}
 

Revision as of 17:03, 14 October 2022

Metabolite LONG-CHAIN-KETONE

  • common-name:
    • a ketone

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality