Difference between revisions of "MALONYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-8-DIHYDROPTEROATE == * common-name: ** 7,8-dihydropteroate * inchi-key: ** wbfyvdchgvnrbh-uhfffaoysa-m * molecular-weight: ** 313.295 *...")
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * inchi-key: ** ghrbcdhnysufrn-iuyqgcfvsa-n * molecu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-8-DIHYDROPTEROATE ==
+
== Metabolite CPD-16953 ==
 
* common-name:
 
* common-name:
** 7,8-dihydropteroate
+
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
 
* inchi-key:
 
* inchi-key:
** wbfyvdchgvnrbh-uhfffaoysa-m
+
** ghrbcdhnysufrn-iuyqgcfvsa-n
 
* molecular-weight:
 
* molecular-weight:
** 313.295
+
** 223.234
 
* smiles:
 
* smiles:
** c(nc1(/c=cc(\c(=o)[o-])=c/c=1))c2(cnc3(\n=c(n)nc(=o)c(\n=2)=3))
+
** c[c@@h]1(c([c@@h](c)o)=nc2(/c(=o)nc(n)=nc(/n1)=2))
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DIHYDROFOLATESYNTH-RXN]]
+
* [[RXN-15733]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2PTEROATESYNTH-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=7,8-dihydropteroate}}
+
{{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
{{#set: inchi-key=inchikey=wbfyvdchgvnrbh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}}
{{#set: molecular-weight=313.295}}
+
{{#set: molecular-weight=223.234}}

Revision as of 17:05, 14 October 2022

Metabolite CPD-16953

  • common-name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • inchi-key:
    • ghrbcdhnysufrn-iuyqgcfvsa-n
  • molecular-weight:
    • 223.234
  • smiles:
    • c[c@@h]1(c([c@@h](c)o)=nc2(/c(=o)nc(n)=nc(/n1)=2))

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.