Difference between revisions of "CPD-12443"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2K-ADIPATE == * common-name: ** 2-oxoadipate * inchi-key: ** fgsbnbbhozhubo-uhfffaoysa-l * molecular-weight: ** 158.11 * smiles: ** c(cc(...")
(Created page with "Category:metabolite == Metabolite CPD-12443 == * common-name: ** perillate == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound ==...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2K-ADIPATE ==
+
== Metabolite CPD-12443 ==
 
* common-name:
 
* common-name:
** 2-oxoadipate
+
** perillate
* inchi-key:
 
** fgsbnbbhozhubo-uhfffaoysa-l
 
* molecular-weight:
 
** 158.11
 
* smiles:
 
** c(cc(=o)c(=o)[o-])cc(=o)[o-]
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2-AMINOADIPATE-AMINOTRANSFERASE-RXN]]
+
* [[RXN-14280]]
* [[RXN-7970]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-oxoadipate}}
+
{{#set: common-name=perillate}}
{{#set: inchi-key=inchikey=fgsbnbbhozhubo-uhfffaoysa-l}}
 
{{#set: molecular-weight=158.11}}
 

Revision as of 07:49, 17 October 2022

Metabolite CPD-12443

  • common-name:
    • perillate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality