Difference between revisions of "CPD-235"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene FISUC_RS02965 == * common-name: ** uvra * transcription-direction: ** negative * centisome-position: ** 18.177032 * left-end-position: ** 698477...") |
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...") |
||
(12 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-235 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phosphonopyruvate |
− | * | + | * inchi-key: |
− | ** | + | ** chddavcoaofsld-uhfffaoysa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 166.027 |
− | * | + | * smiles: |
− | ** | + | ** c(c(=o)c([o-])=o)p([o-])(o)=o |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[4.1.1.82-RXN]] | |
− | = | + | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=3-phosphonopyruvate}} |
− | * | + | {{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}} |
− | {{#set: common-name= | + | {{#set: molecular-weight=166.027}} |
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 17 October 2022
Contents
Metabolite CPD-235
- common-name:
- 3-phosphonopyruvate
- inchi-key:
- chddavcoaofsld-uhfffaoysa-l
- molecular-weight:
- 166.027
- smiles:
- c(c(=o)c([o-])=o)p([o-])(o)=o