Difference between revisions of "CPD-235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FSU_RS07425 == * transcription-direction: ** negative * centisome-position: ** 47.116367 * left-end-position: ** 1810684 * right-end-position: **...")
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...")
 
(11 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FSU_RS07425 ==
+
== Metabolite CPD-235 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 3-phosphonopyruvate
−
* centisome-position:
+
* inchi-key:
−
** 47.116367   
+
** chddavcoaofsld-uhfffaoysa-l
−
* left-end-position:
+
* molecular-weight:
−
** 1810684
+
** 166.027
−
* right-end-position:
+
* smiles:
−
** 1811751
+
** c(c(=o)c([o-])=o)p([o-])(o)=o
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[fibrobacter_22092020]]
+
* [[4.1.1.82-RXN]]
−
== Reaction(s) associated ==
+
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
−
* [[GLUCOKIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[HEXOKINASE-RXN]]
+
{{#set: common-name=3-phosphonopyruvate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}}
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=166.027}}
−
== Pathway(s) associated ==
 
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
−
* [[P122-PWY]]
 
−
** '''17''' reactions found over '''18''' reactions in the full pathway
 
−
* [[PWY-2723]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5514]]
 
−
** '''4''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-5941]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[GLYCOCAT-PWY]]
 
−
** '''7''' reactions found over '''8''' reactions in the full pathway
 
−
* [[ANAGLYCOLYSIS-PWY]]
 
−
** '''11''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-621]]
 
−
** '''2''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-2722]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[TREDEGLOW-PWY]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-5661]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY0-1182]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[GLUCOSE1PMETAB-PWY]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7385]]
 
−
** '''5''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-7238]]
 
−
** '''6''' reactions found over '''8''' reactions in the full pathway
 
−
* [[P124-PWY]]
 
−
** '''14''' reactions found over '''15''' reactions in the full pathway
 
−
* [[UDPNACETYLGALSYN-PWY]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
</div>
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: centisome-position=47.116367    }}
 
−
{{#set: left-end-position=1810684}}
 
−
{{#set: right-end-position=1811751}}
 
−
{{#set: organism associated=fibrobacter_22092020}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=16}}
 

Latest revision as of 11:11, 17 October 2022

Metabolite CPD-235

  • common-name:
    • 3-phosphonopyruvate
  • inchi-key:
    • chddavcoaofsld-uhfffaoysa-l
  • molecular-weight:
    • 166.027
  • smiles:
    • c(c(=o)c([o-])=o)p([o-])(o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=CPD-235&oldid=90364"