|
|
| (9 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene FSU_RS15240 == | + | == Metabolite CPD-235 == |
| − | == Organism(s) associated with this gene ==
| + | * common-name: |
| − | * [[fibrobacter_05102020]] | + | ** 3-phosphonopyruvate |
| − | == Reaction(s) associated ==
| + | * inchi-key: |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | ** chddavcoaofsld-uhfffaoysa-l |
| − | * [[ADENOSINE-KINASE-RXN]] | + | * molecular-weight: |
| − | ** Category: [[orthology]] | + | ** 166.027 |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a | + | * smiles: |
| − | * [[ADENYL-KIN-RXN]]
| + | ** c(c(=o)c([o-])=o)p([o-])(o)=o |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to consume the compound == |
| − | *** source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a
| + | * [[4.1.1.82-RXN]] |
| − | *** source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
| + | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] |
| − | *** source: [[faecalibacterium]]; tool: [[orthofinder]]; comment: n.a
| + | == Reaction(s) known to produce the compound == |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| + | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] |
| − | *** source: [[plantarum]]; tool: [[orthofinder]]; comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * [[CDPKIN-RXN]] | + | {{#set: common-name=3-phosphonopyruvate}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}} |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a | + | {{#set: molecular-weight=166.027}} |
| − | * [[DADPKIN-RXN]]
| |
| − | ** Category: [[orthology]] | |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a | |
| − | * [[DCDPKIN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[DEOXYADENYLATE-KINASE-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a | |
| − | *** source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
| |
| − | *** source: [[faecalibacterium]]; tool: [[orthofinder]]; comment: n.a
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[DGDPKIN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[DTDPKIN-RXN]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[DUDPKIN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[GDPKIN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[RXN-14074]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
| |
| − | *** source: [[faecalibacterium]]; tool: [[orthofinder]]; comment: n.a
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | * [[UDPKIN-RXN]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6619]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7219]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7205]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7227]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7224]]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7220]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7198]]
| |
| − | ** '''5''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7184]]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6545]]
| |
| − | ** '''6''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY0-166]]
| |
| − | ** '''11''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-7210]]
| |
| − | ** '''6''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-7197]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7226]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7222]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7187]]
| |
| − | ** '''7''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7221]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PPGPPMET-PWY]]
| |
| − | ** '''6''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-7176]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: organism associated=fibrobacter_05102020}} | |
| − | {{#set: nb reaction associated=12}} | |
| − | {{#set: nb pathway associated=18}} | |
