Difference between revisions of "CPD-235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FSU_RS08600 == == Organism(s) associated with this gene == * fibrobacter_07102020 == Reaction(s) associated == * 2.1.1.72-RXN ** Category: [...")
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene FSU_RS08600 ==
+
== Metabolite CPD-235 ==
== Organism(s) associated with this gene  ==
+
* common-name:
* [[fibrobacter_07102020]]
+
** 3-phosphonopyruvate
== Reaction(s) associated ==
+
* inchi-key:
* [[2.1.1.72-RXN]]
+
** chddavcoaofsld-uhfffaoysa-l
** Category: [[manual]]
+
* molecular-weight:
*** source: [[reactions_add_147_emile_annot]]; tool: [[unknown-tool]]; comment: present in the annotation part of the emile network.
+
** 166.027
{{#set: organism associated=fibrobacter_07102020}}
+
* smiles:
{{#set: nb reaction associated=1}}
+
** c(c(=o)c([o-])=o)p([o-])(o)=o
 +
== Reaction(s) known to consume the compound ==
 +
* [[4.1.1.82-RXN]]
 +
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=3-phosphonopyruvate}}
 +
{{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}}
 +
{{#set: molecular-weight=166.027}}

Latest revision as of 11:11, 17 October 2022

Metabolite CPD-235

  • common-name:
    • 3-phosphonopyruvate
  • inchi-key:
    • chddavcoaofsld-uhfffaoysa-l
  • molecular-weight:
    • 166.027
  • smiles:
    • c(c(=o)c([o-])=o)p([o-])(o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality