Difference between revisions of "CPD-235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FISUC_RS12885 == * transcription-direction: ** positive * centisome-position: ** 82.27410 * left-end-position: ** 3161493 * right-end-position: *...")
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...")
 
(5 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FISUC_RS12885 ==
+
== Metabolite CPD-235 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 3-phosphonopyruvate
−
* centisome-position:
+
* inchi-key:
−
** 82.27410   
+
** chddavcoaofsld-uhfffaoysa-l
−
* left-end-position:
+
* molecular-weight:
−
** 3161493
+
** 166.027
−
* right-end-position:
+
* smiles:
−
** 3162437
+
** c(c(=o)c([o-])=o)p([o-])(o)=o
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[fibrobacter_final_03112020]]
+
* [[4.1.1.82-RXN]]
−
== Reaction(s) associated ==
+
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
−
* [[NAD-KIN-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[NADH-KINASE-RXN]]
+
{{#set: common-name=3-phosphonopyruvate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}}
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=166.027}}
−
== Pathway(s) associated ==
 
−
* [[NADPHOS-DEPHOS-PWY-1]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7268]]
 
−
** '''5''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7269]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
* [[NADPHOS-DEPHOS-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5083]]
 
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: centisome-position=82.27410    }}
 
−
{{#set: left-end-position=3161493}}
 
−
{{#set: right-end-position=3162437}}
 
−
{{#set: organism associated=fibrobacter_final_03112020}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=5}}
 

Latest revision as of 11:11, 17 October 2022

Metabolite CPD-235

  • common-name:
    • 3-phosphonopyruvate
  • inchi-key:
    • chddavcoaofsld-uhfffaoysa-l
  • molecular-weight:
    • 166.027
  • smiles:
    • c(c(=o)c([o-])=o)p([o-])(o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=CPD-235&oldid=90364"