Difference between revisions of "CPD-235"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 28S-rRNAs == * common-name: ** a 28s rrna == Reaction(s) known to consume the compound == * 3.2.2.22-RXN == Reaction(s) known to prod...")
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 28S-rRNAs ==
+
== Metabolite CPD-235 ==
 
* common-name:
 
* common-name:
** a 28s rrna
+
** 3-phosphonopyruvate
 +
* inchi-key:
 +
** chddavcoaofsld-uhfffaoysa-l
 +
* molecular-weight:
 +
** 166.027
 +
* smiles:
 +
** c(c(=o)c([o-])=o)p([o-])(o)=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.2.22-RXN]]
+
* [[4.1.1.82-RXN]]
 +
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a 28s rrna}}
+
{{#set: common-name=3-phosphonopyruvate}}
 +
{{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}}
 +
{{#set: molecular-weight=166.027}}

Latest revision as of 11:11, 17 October 2022

Metabolite CPD-235

  • common-name:
    • 3-phosphonopyruvate
  • inchi-key:
    • chddavcoaofsld-uhfffaoysa-l
  • molecular-weight:
    • 166.027
  • smiles:
    • c(c(=o)c([o-])=o)p([o-])(o)=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality