Difference between revisions of "CPD-235"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 28S-rRNAs == * common-name: ** a 28s rrna == Reaction(s) known to consume the compound == * 3.2.2.22-RXN == Reaction(s) known to prod...") |
(Created page with "Category:metabolite == Metabolite CPD-235 == * common-name: ** 3-phosphonopyruvate * inchi-key: ** chddavcoaofsld-uhfffaoysa-l * molecular-weight: ** 166.027 * smiles: **...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-235 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-phosphonopyruvate |
+ | * inchi-key: | ||
+ | ** chddavcoaofsld-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 166.027 | ||
+ | * smiles: | ||
+ | ** c(c(=o)c([o-])=o)p([o-])(o)=o | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[4.1.1.82-RXN]] |
+ | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[PHOSPHOENOLPYRUVATE-MUTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-phosphonopyruvate}} |
+ | {{#set: inchi-key=inchikey=chddavcoaofsld-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=166.027}} |
Latest revision as of 11:11, 17 October 2022
Contents
Metabolite CPD-235
- common-name:
- 3-phosphonopyruvate
- inchi-key:
- chddavcoaofsld-uhfffaoysa-l
- molecular-weight:
- 166.027
- smiles:
- c(c(=o)c([o-])=o)p([o-])(o)=o