Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FSU_RS11275 == * common-name: ** pure * transcription-direction: ** positive * centisome-position: ** 71.77138 * left-end-position: ** 2758177 *...")
 
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...")
 
(16 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene FSU_RS11275 ==
+
== Metabolite 4-hydroxybenzoate ==
 
* common-name:
 
* common-name:
−
** pure
+
** 4-hydroxybenzoate
−
* transcription-direction:
+
* inchi-key:
−
** positive
+
** fjkrolugyxjwqn-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 71.77138   
+
** 137.115
−
* left-end-position:
+
* smiles:
−
** 2758177
+
** c(c1(/c=cc(\o)=c/c=1))(=o)[o-]
−
* right-end-position:
+
== Reaction(s) known to consume the compound ==
−
** 2758656
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to produce the compound ==
−
* [[fibrobacter_15062020]]
+
== Reaction(s) of unknown directionality ==
−
== Reaction(s) associated ==
+
{{#set: common-name=4-hydroxybenzoate}}
−
* [[AIRCARBOXY-RXN]]
+
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=137.115}}
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-743]]
 
−
** Category: [[annotation]]
 
−
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
 
−
*** source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6124]]
 
−
** '''4''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7234]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-6123]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
{{#set: common-name=pure}}
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: centisome-position=71.77138    }}
 
−
{{#set: left-end-position=2758177}}
 
−
{{#set: right-end-position=2758656}}
 
−
{{#set: organism associated=fibrobacter_15062020}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=3}}
 

Latest revision as of 11:12, 17 October 2022

Metabolite 4-hydroxybenzoate

  • common-name:
    • 4-hydroxybenzoate
  • inchi-key:
    • fjkrolugyxjwqn-uhfffaoysa-m
  • molecular-weight:
    • 137.115
  • smiles:
    • c(c1(/c=cc(\o)=c/c=1))(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=4-hydroxybenzoate&oldid=90520"