Difference between revisions of "4-hydroxybenzoate"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene FSU_RS11275 == * common-name: ** pure * transcription-direction: ** positive * centisome-position: ** 71.77138 * left-end-position: ** 2758177 *...") |
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...") |
||
(16 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite 4-hydroxybenzoate == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxybenzoate |
− | * | + | * inchi-key: |
− | ** | + | ** fjkrolugyxjwqn-uhfffaoysa-m |
− | * | + | * molecular-weight: |
− | ** | + | ** 137.115 |
− | * | + | * smiles: |
− | ** | + | ** c(c1(/c=cc(\o)=c/c=1))(=o)[o-] |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == Reaction(s) | + | {{#set: common-name=4-hydroxybenzoate}} |
− | * [[ | + | {{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}} |
− | + | {{#set: molecular-weight=137.115}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:12, 17 October 2022
Contents
Metabolite 4-hydroxybenzoate
- common-name:
- 4-hydroxybenzoate
- inchi-key:
- fjkrolugyxjwqn-uhfffaoysa-m
- molecular-weight:
- 137.115
- smiles:
- c(c1(/c=cc(\o)=c/c=1))(=o)[o-]