Difference between revisions of "4-hydroxybenzoate"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FISUC_RS05525 == * transcription-direction: ** negative * centisome-position: ** 35.495617 * left-end-position: ** 1363967 * right-end-position:...")
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene FISUC_RS05525 ==
+
== Metabolite 4-hydroxybenzoate ==
* transcription-direction:
+
* common-name:
** negative
+
** 4-hydroxybenzoate
* centisome-position:
+
* inchi-key:
** 35.495617   
+
** fjkrolugyxjwqn-uhfffaoysa-m
* left-end-position:
+
* molecular-weight:
** 1363967
+
** 137.115
* right-end-position:
+
* smiles:
** 1365034
+
** c(c1(/c=cc(\o)=c/c=1))(=o)[o-]
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[fibrobacter_final_03112020]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[GLUCOKIN-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=4-hydroxybenzoate}}
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
* [[HEXOKINASE-RXN]]
+
{{#set: molecular-weight=137.115}}
** Category: [[annotation]]
 
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[P122-PWY]]
 
** '''17''' reactions found over '''18''' reactions in the full pathway
 
* [[PWY-2723]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5514]]
 
** '''4''' reactions found over '''7''' reactions in the full pathway
 
* [[PWY-5941]]
 
** '''6''' reactions found over '''6''' reactions in the full pathway
 
* [[GLYCOCAT-PWY]]
 
** '''8''' reactions found over '''8''' reactions in the full pathway
 
* [[ANAGLYCOLYSIS-PWY]]
 
** '''11''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-621]]
 
** '''2''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-2722]]
 
** '''1''' reactions found over '''3''' reactions in the full pathway
 
* [[TREDEGLOW-PWY]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-5661]]
 
** '''2''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY0-1182]]
 
** '''1''' reactions found over '''2''' reactions in the full pathway
 
* [[GLUCOSE1PMETAB-PWY]]
 
** '''3''' reactions found over '''5''' reactions in the full pathway
 
* [[PWY-7385]]
 
** '''5''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7238]]
 
** '''6''' reactions found over '''8''' reactions in the full pathway
 
* [[P124-PWY]]
 
** '''14''' reactions found over '''15''' reactions in the full pathway
 
* [[UDPNACETYLGALSYN-PWY]]
 
** '''4''' reactions found over '''6''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=negative}}
 
{{#set: centisome-position=35.495617    }}
 
{{#set: left-end-position=1363967}}
 
{{#set: right-end-position=1365034}}
 
{{#set: organism associated=fibrobacter_final_03112020}}
 
{{#set: nb reaction associated=2}}
 
{{#set: nb pathway associated=16}}
 

Latest revision as of 11:12, 17 October 2022

Metabolite 4-hydroxybenzoate

  • common-name:
    • 4-hydroxybenzoate
  • inchi-key:
    • fjkrolugyxjwqn-uhfffaoysa-m
  • molecular-weight:
    • 137.115
  • smiles:
    • c(c1(/c=cc(\o)=c/c=1))(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality