Difference between revisions of "4-hydroxybenzoate"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LONG-CHAIN-KETONE == * common-name: ** a ketone == Reaction(s) known to consume the compound == * RXN-12448 == Reaction(s) known to p...") |
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoysa-m * molecular-weight: ** 137.115 * smi...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 4-hydroxybenzoate == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-hydroxybenzoate |
+ | * inchi-key: | ||
+ | ** fjkrolugyxjwqn-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 137.115 | ||
+ | * smiles: | ||
+ | ** c(c1(/c=cc(\o)=c/c=1))(=o)[o-] | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-hydroxybenzoate}} |
+ | {{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=137.115}} |
Latest revision as of 11:12, 17 October 2022
Contents
Metabolite 4-hydroxybenzoate
- common-name:
- 4-hydroxybenzoate
- inchi-key:
- fjkrolugyxjwqn-uhfffaoysa-m
- molecular-weight:
- 137.115
- smiles:
- c(c1(/c=cc(\o)=c/c=1))(=o)[o-]