Difference between revisions of "CPDQT-37"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene FSU_RS04975 == * transcription-direction: ** positive * centisome-position: ** 30.516752 * left-end-position: ** 1172760 * right-end-position: **...") |
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * common-name: ** 3-[(4'-methylsulfanyl)butyl]malate * inchi-key: ** zizldvklmyvmnx-uhfffaoysa-l * molecular-weight: ** 234.2...") |
||
(10 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPDQT-37 == |
− | * | + | * common-name: |
− | ** | + | ** 3-[(4'-methylsulfanyl)butyl]malate |
− | * | + | * inchi-key: |
− | ** | + | ** zizldvklmyvmnx-uhfffaoysa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 234.267 |
− | * | + | * smiles: |
− | ** | + | ** csccccc(c(o)c(=o)[o-])c(=o)[o-] |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[RXN-18206]] | |
− | == Reaction(s) | + | * [[RXNQT-4168]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-18206]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-[(4'-methylsulfanyl)butyl]malate}} | |
− | {{#set: | + | {{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}} |
− | + | {{#set: molecular-weight=234.267}} | |
− | {{#set: | ||
− | |||
− | {{#set: |
Latest revision as of 11:13, 17 October 2022
Contents
Metabolite CPDQT-37
- common-name:
- 3-[(4'-methylsulfanyl)butyl]malate
- inchi-key:
- zizldvklmyvmnx-uhfffaoysa-l
- molecular-weight:
- 234.267
- smiles:
- csccccc(c(o)c(=o)[o-])c(=o)[o-]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(4'-methylsulfanyl)butyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.