Difference between revisions of "CPDQT-37"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene FSU_RS14005 == * common-name: ** ispg * transcription-direction: ** positive * centisome-position: ** 88.66478 * left-end-position: ** 3407391 *...")
(Created page with "Category:metabolite == Metabolite CPDQT-37 == * common-name: ** 3-[(4'-methylsulfanyl)butyl]malate * inchi-key: ** zizldvklmyvmnx-uhfffaoysa-l * molecular-weight: ** 234.2...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene FSU_RS14005 ==
+
== Metabolite CPDQT-37 ==
 
* common-name:
 
* common-name:
** ispg
+
** 3-[(4'-methylsulfanyl)butyl]malate
* transcription-direction:
+
* inchi-key:
** positive
+
** zizldvklmyvmnx-uhfffaoysa-l
* centisome-position:
+
* molecular-weight:
** 88.66478   
+
** 234.267
* left-end-position:
+
* smiles:
** 3407391
+
** csccccc(c(o)c(=o)[o-])c(=o)[o-]
* right-end-position:
+
== Reaction(s) known to consume the compound ==
** 3409130
+
* [[RXN-18206]]
== Organism(s) associated with this gene  ==
+
* [[RXNQT-4168]]
* [[fibrobacter_final_03112020]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-18206]]
* [[RXN0-882]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=3-[(4'-methylsulfanyl)butyl]malate}}
*** source: [[genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=zizldvklmyvmnx-uhfffaoysa-l}}
== Pathway(s) associated ==
+
{{#set: molecular-weight=234.267}}
* [[PWY-7560]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
{{#set: common-name=ispg}}
 
{{#set: transcription-direction=positive}}
 
{{#set: centisome-position=88.66478    }}
 
{{#set: left-end-position=3407391}}
 
{{#set: right-end-position=3409130}}
 
{{#set: organism associated=fibrobacter_final_03112020}}
 
{{#set: nb reaction associated=1}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 17 October 2022

Metabolite CPDQT-37

  • common-name:
    • 3-[(4'-methylsulfanyl)butyl]malate
  • inchi-key:
    • zizldvklmyvmnx-uhfffaoysa-l
  • molecular-weight:
    • 234.267
  • smiles:
    • csccccc(c(o)c(=o)[o-])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "3-[(4'-methylsulfanyl)butyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.