Difference between revisions of "CPD-407"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL == * common-name: ** 3-(all-trans-octaprenyl)benzene-1,2-diol * inchi-key: ** ynpgymzvnlizld-bqfktqoqsa-n *...")
(Created page with "Category:metabolite == Metabolite CPD-407 == * common-name: ** γ-l-glutamyl-d-alanine * inchi-key: ** wqxxxvrafakqjm-uhnvwzdzsa-m * molecular-weight: ** 217.201 * sm...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-OCTAPRENYL-6-HYDROXYPHENOL ==
+
== Metabolite CPD-407 ==
 
* common-name:
 
* common-name:
** 3-(all-trans-octaprenyl)benzene-1,2-diol
+
** γ-l-glutamyl-d-alanine
 
* inchi-key:
 
* inchi-key:
** ynpgymzvnlizld-bqfktqoqsa-n
+
** wqxxxvrafakqjm-uhnvwzdzsa-m
 
* molecular-weight:
 
* molecular-weight:
** 655.058
+
** 217.201
 
* smiles:
 
* smiles:
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(/o)=c(c=cc=1)/o)
+
** c[c@@h](nc(=o)cc[c@h]([n+])c(=o)[o-])c(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2-OCTAPRENYL-6-OHPHENOL-METHY-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-20406]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-octaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=γ-l-glutamyl-d-alanine}}
{{#set: inchi-key=inchikey=ynpgymzvnlizld-bqfktqoqsa-n}}
+
{{#set: inchi-key=inchikey=wqxxxvrafakqjm-uhnvwzdzsa-m}}
{{#set: molecular-weight=655.058}}
+
{{#set: molecular-weight=217.201}}

Latest revision as of 11:13, 17 October 2022

Metabolite CPD-407

  • common-name:
    • γ-l-glutamyl-d-alanine
  • inchi-key:
    • wqxxxvrafakqjm-uhnvwzdzsa-m
  • molecular-weight:
    • 217.201
  • smiles:
    • c[c@@h](nc(=o)cc[c@h]([n+])c(=o)[o-])c(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality