Difference between revisions of "RXN0-382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-205 == * common-name: ** pimelate * inchi-key: ** wljvntcwhirura-uhfffaoysa-l * molecular-weight: ** 158.154 * smiles: ** c([o-])(=o)...")
(Created page with "Category:reaction == Reaction RXN0-382 == * ec-number: ** [http://enzyme.expasy.org/EC/2.7.1 ec-2.7.1] * direction: ** left-to-right == Reaction formula == * 1 ATP[c]...")
 
(12 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite CPD-205 ==
+
== Reaction RXN0-382 ==
* common-name:
+
* ec-number:
** pimelate
+
** [http://enzyme.expasy.org/EC/2.7.1 ec-2.7.1]
* inchi-key:
+
* direction:
** wljvntcwhirura-uhfffaoysa-l
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 158.154
+
* 1 [[ATP]][c] '''+''' 1 [[CPD-1093]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[DEOXYXYLULOSE-5P]][c] '''+''' 1 [[PROTON]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c([o-])(=o)cccccc([o-])=o
+
* Gene: [[FSU_RS03375]]
== Reaction(s) known to consume the compound ==
+
** Category: [[orthology]]
* [[6-CARBOXYHEXANOATE--COA-LIGASE-RXN]]
+
*** Source: [[ecoli]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
== Reaction(s) known to produce the compound ==
+
*** Source: [[bifidobacterium]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
== Reaction(s) of unknown directionality ==
+
== Pathway(s) ==
{{#set: common-name=pimelate}}
+
== Reconstruction information  ==
{{#set: inchi-key=inchikey=wljvntcwhirura-uhfffaoysa-l}}
+
* category: [[orthology]]; source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
{{#set: molecular-weight=158.154}}
+
* category: [[orthology]]; source: [[bifidobacterium]]; tool: [[orthofinder]]; comment: n.a
 +
== External links  ==
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27991 27991]
 +
{{#set: ec-number=ec-2.7.1}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=1}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction tool=orthofinder}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=bifidobacterium|ecoli}}

Latest revision as of 11:15, 17 October 2022

Reaction RXN0-382

  • ec-number:
  • direction:
    • left-to-right

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links