Difference between revisions of "TransportSeed-ISOBUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9646 == * common-name: ** di-trans,octa-cis-undecaprenyl phosphate * inchi-key: ** ufphfkctoziafy-ntdveaecsa-l * molecular-weight: **...")
(Created page with "Category:reaction == Reaction TransportSeed-ISOBUTYRATE == * direction: ** left-to-right == Reaction formula == * 1.0 ISOBUTYRATE[e] '''=>''' 1.0 ISOBUTYRATE[c] ==...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite CPD-9646 ==
+
== Reaction TransportSeed-ISOBUTYRATE ==
* common-name:
+
* direction:
** di-trans,octa-cis-undecaprenyl phosphate
+
** left-to-right
* inchi-key:
+
== Reaction formula ==
** ufphfkctoziafy-ntdveaecsa-l
+
* 1.0 [[ISOBUTYRATE]][e] '''=>''' 1.0 [[ISOBUTYRATE]][c]
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
** 845.279
+
== Pathway(s) ==
* smiles:
+
== Reconstruction information  ==
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop(=o)([o-])[o-]
+
* category: [[manual]]; source: [[import_from_medium]]; tool: [[curation]]; comment: added to manage seeds from extracellular to cytosol compartment
== Reaction(s) known to consume the compound ==
+
== External links  ==
* [[2.7.8.6-RXN]]
+
{{#set: direction=left-to-right}}
* [[PHOSNACMURPENTATRANS-RXN]]
+
{{#set: nb gene associated=0}}
* [[RXN-11347]]
+
{{#set: nb pathway associated=0}}
* [[RXN-8975]]
+
{{#set: reconstruction category=manual}}
== Reaction(s) known to produce the compound ==
+
{{#set: reconstruction tool=curation}}
* [[2.7.8.6-RXN]]
+
{{#set: reconstruction comment=added to manage seeds from extracellular to cytosol compartment}}
* [[RXN-8975]]
+
{{#set: reconstruction source=import_from_medium}}
* [[UNDECAPRENYL-DIPHOSPHATASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=di-trans,octa-cis-undecaprenyl phosphate}}
 
{{#set: inchi-key=inchikey=ufphfkctoziafy-ntdveaecsa-l}}
 
{{#set: molecular-weight=845.279}}
 

Latest revision as of 11:15, 17 October 2022

Reaction TransportSeed-ISOBUTYRATE

  • direction:
    • left-to-right

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links