Difference between revisions of "RXN-16621"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * inchi-key: ** duugkqcegzlzno-uhfffaoysa-m * molecular-weight: ** 1...")
(Created page with "Category:reaction == Reaction RXN-16621 == * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179] ** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41] * dir...")
 
(14 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite 5-HYDROXYINDOLE_ACETATE ==
+
== Reaction RXN-16621 ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
−
** 5-hydroxyindole acetate
+
** beta-ketoacyl-acp synthase ii
−
* inchi-key:
+
== Reaction formula ==
−
** duugkqcegzlzno-uhfffaoysa-m
+
* 1 [[5Z-tetradec-5-enoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[7Z-3-oxo-hexadec-7-enoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
−
** 190.178
+
* Gene: [[FISUC_RS15410]]
−
* smiles:
+
** Category: [[annotation]]
−
** c([o-])(=o)cc1(/c2(/c(\nc=1)=c/c=c(o)c=2))
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) known to consume the compound ==
+
* Gene: [[FISUC_RS15210]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[RXN-10780]]
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) of unknown directionality ==
+
* Gene: [[FSU_RS01400]]
−
{{#set: common-name=5-hydroxyindole acetate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
{{#set: molecular-weight=190.178}}
+
* Gene: [[FSU_RS01605]]
 +
** Category: [[annotation]]
 +
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 +
== Pathway(s) ==
 +
* [[PWY-7664]], oleate biosynthesis IV (anaerobic):
 +
** '''10''' reactions found over '''14''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
{{#set: ec-number=ec-2.3.1.41|ec-2.3.1.179}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=beta-ketoacyl-acp synthase ii}}
 +
{{#set: nb gene associated=4}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=fibrobacter_succinogenes2|fibrobacter_succinogenes1}}

Latest revision as of 11:15, 17 October 2022

Reaction RXN-16621

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-7664, oleate biosynthesis IV (anaerobic):
    • 10 reactions found over 14 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=RXN-16621&oldid=92224"