Difference between revisions of "2.1.1.151-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 5-HYDROXYINDOLE_ACETATE == * common-name: ** 5-hydroxyindole acetate * inchi-key: ** duugkqcegzlzno-uhfffaoysa-m * molecular-weight: ** 1...")
(Created page with "Category:reaction == Reaction 2.1.1.151-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/2.1.1.151 ec-2.1.1.151] * direction: ** left-to-right == Reaction formula == *...")
 
(11 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite 5-HYDROXYINDOLE_ACETATE ==
+
== Reaction 2.1.1.151-RXN ==
* common-name:
+
* ec-number:
** 5-hydroxyindole acetate
+
** [http://enzyme.expasy.org/EC/2.1.1.151 ec-2.1.1.151]
* inchi-key:
+
* direction:
** duugkqcegzlzno-uhfffaoysa-m
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 190.178
+
* 1 [[COBALT-SIROHYDROCHLORIN]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[COBALT-FACTOR-III]][c] '''+''' 1 [[PROTON]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c([o-])(=o)cc1(/c2(/c(\nc=1)=c/c=c(o)c=2))
+
== Pathway(s) ==
== Reaction(s) known to consume the compound ==
+
* [[PWY-7377]], cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion):
== Reaction(s) known to produce the compound ==
+
** '''15''' reactions found over '''15''' reactions in the full pathway
* [[RXN-10780]]
+
== Reconstruction information  ==
== Reaction(s) of unknown directionality ==
+
* category: [[manual]]; source: [[add_reactions_to_reach_targets]]; tool: [[curation]]; comment: added to reach cpd-691
{{#set: common-name=5-hydroxyindole acetate}}
+
== External links  ==
{{#set: inchi-key=inchikey=duugkqcegzlzno-uhfffaoysa-m}}
+
* LIGAND-RXN:
{{#set: molecular-weight=190.178}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R05808 R05808]
 +
{{#set: ec-number=ec-2.1.1.151}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=manual}}
 +
{{#set: reconstruction tool=curation}}
 +
{{#set: reconstruction comment=added to reach cpd-691}}
 +
{{#set: reconstruction source=add_reactions_to_reach_targets}}

Latest revision as of 11:15, 17 October 2022

Reaction 2.1.1.151-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-7377, cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion):
    • 15 reactions found over 15 reactions in the full pathway

Reconstruction information

External links