Difference between revisions of "RXN-16380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-weight: ** 167.164 * smiles: ** cc1(\n=c...")
(Created page with "Category:reaction == Reaction RXN-16380 == * ec-number: ** [http://enzyme.expasy.org/EC/6.2.1.3 ec-6.2.1.3] * direction: ** left-to-right * common-name: ** long-chain fatt...")
 
(12 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite PYRIDOXAL ==
+
== Reaction RXN-16380 ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/6.2.1.3 ec-6.2.1.3]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
** pyridoxal
+
** long-chain fatty acid--coa ligase
* inchi-key:
+
== Reaction formula ==
** radkzdmfgjycbb-uhfffaoysa-n
+
* 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[STEARIC_ACID]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[STEAROYL-COA]][c]
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
** 167.164
+
* Gene: [[FISUC_RS12045]]
* smiles:
+
** Category: [[annotation]]
** cc1(\n=cc(/co)=c(c(\o)=1)/c=o)
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
== Reaction(s) known to consume the compound ==
+
* Gene: [[FSU_RS14015]]
* [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
+
** Category: [[annotation]]
* [[PYRIDOXKIN-RXN]]
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: automated-name-match, Comment: n.a
* [[PYROXALTRANSAM-RXN]]
+
** Category: [[orthology]]
== Reaction(s) known to produce the compound ==
+
*** Source: [[faecalibacterium]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
* [[PYROXALTRANSAM-RXN]]
+
*** Source: [[bthetaiotaomicron]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
== Reaction(s) of unknown directionality ==
+
== Pathway(s) ==
{{#set: common-name=pyridoxal}}
+
* [[PWY-5989]], stearate biosynthesis II (bacteria and plants):
{{#set: inchi-key=inchikey=radkzdmfgjycbb-uhfffaoysa-n}}
+
** '''4''' reactions found over '''6''' reactions in the full pathway
{{#set: molecular-weight=167.164}}
+
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[orthology]]; source: [[faecalibacterium]]; tool: [[orthofinder]]; comment: n.a
 +
* category: [[orthology]]; source: [[bthetaiotaomicron]]; tool: [[orthofinder]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
{{#set: ec-number=ec-6.2.1.3}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=long-chain fatty acid--coa ligase}}
 +
{{#set: nb gene associated=2}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction tool=orthofinder|pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=fibrobacter_succinogenes2|faecalibacterium|fibrobacter_succinogenes1|bthetaiotaomicron}}

Latest revision as of 11:16, 17 October 2022

Reaction RXN-16380

  • ec-number:
  • direction:
    • left-to-right
  • common-name:
    • long-chain fatty acid--coa ligase

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-5989, stearate biosynthesis II (bacteria and plants):
    • 4 reactions found over 6 reactions in the full pathway

Reconstruction information

External links