Difference between revisions of "6.3.1.4-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite HOMO-CIT == * common-name: ** (2r)-homocitrate * inchi-key: ** xkjvevrqmlksmo-ssdottswsa-k * molecular-weight: ** 203.128 * smiles: ** c(...")
(Created page with "Category:reaction == Reaction 6.3.1.4-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/6.3.1.4 ec-6.3.1.4] * direction: ** left-to-right == Reaction formula == * 1 AM...")
 
(9 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite HOMO-CIT ==
+
== Reaction 6.3.1.4-RXN ==
* common-name:
+
* ec-number:
** (2r)-homocitrate
+
** [http://enzyme.expasy.org/EC/6.3.1.4 ec-6.3.1.4]
* inchi-key:
+
* direction:
** xkjvevrqmlksmo-ssdottswsa-k
+
** left-to-right
* molecular-weight:
+
== Reaction formula ==
** 203.128
+
* 1 [[AMMONIUM]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[L-ASPARTATE]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[ASN]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c]
* smiles:
+
== Gene(s) associated with this reaction  ==
** c(c([o-])=o)c[c@](o)(c([o-])=o)cc([o-])=o
+
== Pathway(s) ==
== Reaction(s) known to consume the compound ==
+
== Reconstruction information  ==
* [[HOMOCITRATE-SYNTHASE-RXN]]
+
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_spontaneous]]; tool: [[meneco]]; comment: added for gapfilling
* [[RXN-13722]]
+
== External links  ==
== Reaction(s) known to produce the compound ==
+
* RHEA:
* [[HOMOCITRATE-SYNTHASE-RXN]]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14197 14197]
* [[RXN-13722]]
+
* LIGAND-RXN:
== Reaction(s) of unknown directionality ==
+
** [http://www.genome.jp/dbget-bin/www_bget?R00482 R00482]
{{#set: common-name=(2r)-homocitrate}}
+
{{#set: ec-number=ec-6.3.1.4}}
{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
+
{{#set: direction=left-to-right}}
{{#set: molecular-weight=203.128}}
+
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=gap-filling}}
 +
{{#set: reconstruction tool=meneco}}
 +
{{#set: reconstruction comment=added for gapfilling}}
 +
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_spontaneous}}

Latest revision as of 11:16, 17 October 2022

Reaction 6.3.1.4-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links