Difference between revisions of "2.6.1.70-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THZ-P == * common-name: ** 4-methyl-5-(2-phosphooxyethyl)thiazole * inchi-key: ** ocymerzcmyjqqo-uhfffaoysa-l * molecular-weight: ** 221....")
(Created page with "Category:reaction == Reaction 2.6.1.70-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/2.6.1.70 ec-2.6.1.70] * direction: ** reversible == Reaction formula == * 1 L-...")
 
(6 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite THZ-P ==
+
== Reaction 2.6.1.70-RXN ==
−
* common-name:
+
* ec-number:
−
** 4-methyl-5-(2-phosphooxyethyl)thiazole
+
** [http://enzyme.expasy.org/EC/2.6.1.70 ec-2.6.1.70]
−
* inchi-key:
+
* direction:
−
** ocymerzcmyjqqo-uhfffaoysa-l
+
** reversible
−
* molecular-weight:
+
== Reaction formula ==
−
** 221.167
+
* 1 [[L-ASPARTATE]][c] '''+''' 1 [[PHENYL-PYRUVATE]][c] '''<=>''' 1 [[OXALACETIC_ACID]][c] '''+''' 1 [[PHE]][c]
−
* smiles:
+
== Gene(s) associated with this reaction  ==
−
** cc1(/n=csc(\ccop([o-])(=o)[o-])=1)
+
== Pathway(s) ==
−
== Reaction(s) known to consume the compound ==
+
== Reconstruction information  ==
−
* [[THI-P-SYN-RXN]]
+
* category: [[gap-filling]]; source: [[gapfilling_solution_with_meneco_draft_spontaneous]]; tool: [[meneco]]; comment: added for gapfilling
−
== Reaction(s) known to produce the compound ==
+
== External links  ==
−
* [[RXNQT-4301]]
+
* RHEA:
−
== Reaction(s) of unknown directionality ==
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14100 14100]
−
{{#set: common-name=4-methyl-5-(2-phosphooxyethyl)thiazole}}
+
* LIGAND-RXN:
−
{{#set: inchi-key=inchikey=ocymerzcmyjqqo-uhfffaoysa-l}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R00695 R00695]
−
{{#set: molecular-weight=221.167}}
+
{{#set: ec-number=ec-2.6.1.70}}
 +
{{#set: direction=reversible}}
 +
{{#set: nb gene associated=0}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=gap-filling}}
 +
{{#set: reconstruction tool=meneco}}
 +
{{#set: reconstruction comment=added for gapfilling}}
 +
{{#set: reconstruction source=gapfilling_solution_with_meneco_draft_spontaneous}}

Latest revision as of 11:17, 17 October 2022

Reaction 2.6.1.70-RXN

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links





Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=2.6.1.70-RXN&oldid=92832"