Difference between revisions of "RXN-10658"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12117 == * common-name: ** demethylmenaquinol-7 * inchi-key: ** ufzdimbxtvrbds-ssqlmynasa-n * molecular-weight: ** 636.999 * smiles:...")
(Created page with "Category:reaction == Reaction RXN-10658 == * ec-number: ** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179] ** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41] * dir...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite CPD-12117 ==
+
== Reaction RXN-10658 ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.179 ec-2.3.1.179]
 +
** [http://enzyme.expasy.org/EC/2.3.1.41 ec-2.3.1.41]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
−
** demethylmenaquinol-7
+
** beta-ketoacyl-acp synthase ii
−
* inchi-key:
+
== Reaction formula ==
−
** ufzdimbxtvrbds-ssqlmynasa-n
+
* 1 [[Cis-Delta7-tetradecenoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-oxo-cis-D9-hexadecenoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
−
** 636.999
+
* Gene: [[FSU_RS01605]]
−
* smiles:
+
** Category: [[annotation]]
−
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c=c(o)c2(\c=cc=cc(/c(\o)=1)=2))
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) known to consume the compound ==
+
* Gene: [[FISUC_RS15410]]
−
* [[RXN-9191]]
+
** Category: [[annotation]]
−
== Reaction(s) known to produce the compound ==
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
* [[RXN-9190]]
+
* Gene: [[FISUC_RS15210]]
−
== Reaction(s) of unknown directionality ==
+
** Category: [[annotation]]
−
{{#set: common-name=demethylmenaquinol-7}}
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
{{#set: inchi-key=inchikey=ufzdimbxtvrbds-ssqlmynasa-n}}
+
* Gene: [[FSU_RS01400]]
−
{{#set: molecular-weight=636.999}}
+
** Category: [[annotation]]
 +
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 +
== Pathway(s) ==
 +
* [[PWY-6282]], palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate):
 +
** '''6''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
{{#set: ec-number=ec-2.3.1.41|ec-2.3.1.179}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=beta-ketoacyl-acp synthase ii}}
 +
{{#set: nb gene associated=4}}
 +
{{#set: nb pathway associated=1}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=fibrobacter_succinogenes2|fibrobacter_succinogenes1}}

Latest revision as of 11:18, 17 October 2022

Reaction RXN-10658

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

  • PWY-6282, palmitoleate biosynthesis I (from (5Z)-dodec-5-enoate):
    • 6 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=RXN-10658&oldid=93099"