Difference between revisions of "3.1.26.4-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * inchi-key: ** cqqnnqtxugluev-uhfffaoys...")
(Created page with "Category:reaction == Reaction 3.1.26.4-RXN == * ec-number: ** [http://enzyme.expasy.org/EC/3.1.26.4 ec-3.1.26.4] * direction: ** left-to-right * common-name: ** ribonuclea...")
 
(11 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:reaction]]
== Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE ==
+
== Reaction 3.1.26.4-RXN ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/3.1.26.4 ec-3.1.26.4]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
** 6-(hydroxymethyl)-7,8-dihydropterin
+
** ribonuclease h
* inchi-key:
+
** ribonuclease hii
** cqqnnqtxugluev-uhfffaoysa-n
+
== Reaction formula ==
* molecular-weight:
+
* 1 [[RNA-DNA-hybrids]][c] '''+''' n [[WATER]][c] '''=>''' 1 [[DNA-Holder]][c] '''+''' n [[Nucleoside-Monophosphates]][c]
** 195.18
+
== Gene(s) associated with this reaction  ==
* smiles:
+
* Gene: [[FSU_RS15575]]
** c(o)c1(=nc2(/c(=o)nc(n)=nc(/nc1)=2))
+
** Category: [[annotation]]
== Reaction(s) known to consume the compound ==
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
* Gene: [[FSU_RS01150]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[H2NEOPTERINALDOL-RXN]]
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
* [[RXN-10857]]
+
* Gene: [[FISUC_RS13600]]
* [[RXN-18377]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
+
* Gene: [[FISUC_RS14960]]
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
+
** Category: [[annotation]]
{{#set: molecular-weight=195.18}}
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 +
== Pathway(s) ==
 +
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* UNIPROT:
 +
** [http://www.uniprot.org/uniprot/P52975 P52975]
 +
** [http://www.uniprot.org/uniprot/Q9CDG3 Q9CDG3]
 +
** [http://www.uniprot.org/uniprot/Q9PM39 Q9PM39]
 +
** [http://www.uniprot.org/uniprot/Q9JX40 Q9JX40]
 +
** [http://www.uniprot.org/uniprot/P43807 P43807]
 +
** [http://www.uniprot.org/uniprot/P43808 P43808]
 +
** [http://www.uniprot.org/uniprot/Q9PJA1 Q9PJA1]
 +
** [http://www.uniprot.org/uniprot/Q9CG17 Q9CG17]
 +
** [http://www.uniprot.org/uniprot/Q9JTD9 Q9JTD9]
 +
** [http://www.uniprot.org/uniprot/Q57599 Q57599]
 +
** [http://www.uniprot.org/uniprot/O44114 O44114]
 +
** [http://www.uniprot.org/uniprot/P0A7Y4 P0A7Y4]
 +
** [http://www.uniprot.org/uniprot/P10442 P10442]
 +
** [http://www.uniprot.org/uniprot/P13319 P13319]
 +
** [http://www.uniprot.org/uniprot/Q7LYY8 Q7LYY8]
 +
** [http://www.uniprot.org/uniprot/P0A2B9 P0A2B9]
 +
** [http://www.uniprot.org/uniprot/Q04740 Q04740]
 +
** [http://www.uniprot.org/uniprot/Q49050 Q49050]
 +
** [http://www.uniprot.org/uniprot/O69014 O69014]
 +
** [http://www.uniprot.org/uniprot/Q54222 Q54222]
 +
</div>
 +
{{#set: ec-number=ec-3.1.26.4}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=ribonuclease hii|ribonuclease h}}
 +
{{#set: nb gene associated=4}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=fibrobacter_succinogenes2|fibrobacter_succinogenes1}}

Latest revision as of 11:18, 17 October 2022

Reaction 3.1.26.4-RXN

  • ec-number:
  • direction:
    • left-to-right
  • common-name:
    • ribonuclease h
    • ribonuclease hii

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links