Difference between revisions of "RXN0-383"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-ACETO-LACTATE == * common-name: ** (s)-2-acetolactate * inchi-key: ** nmdwgegfjubklb-yfkpbyrvsa-m * molecular-weight: ** 131.108 * smil...")
(Created page with "Category:reaction == Reaction RXN0-383 == * ec-number: ** [http://enzyme.expasy.org/EC/3.6.1.9 ec-3.6.1.9] ** [http://enzyme.expasy.org/EC/3.6.1.65 ec-3.6.1.65] * directio...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:reaction]]
−
== Metabolite 2-ACETO-LACTATE ==
+
== Reaction RXN0-383 ==
 +
* ec-number:
 +
** [http://enzyme.expasy.org/EC/3.6.1.9 ec-3.6.1.9]
 +
** [http://enzyme.expasy.org/EC/3.6.1.65 ec-3.6.1.65]
 +
* direction:
 +
** left-to-right
 
* common-name:
 
* common-name:
−
** (s)-2-acetolactate
+
** nucleoside triphosphate pyrophosphohydrolase
−
* inchi-key:
+
== Reaction formula ==
−
** nmdwgegfjubklb-yfkpbyrvsa-m
+
* 1 [[CTP]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
−
* molecular-weight:
+
== Gene(s) associated with this reaction  ==
−
** 131.108
+
* Gene: [[FSU_RS06495]]
−
* smiles:
+
** Category: [[orthology]]
−
** cc(=o)[c@](c)(o)c(=o)[o-]
+
*** Source: [[ecoli]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
−
== Reaction(s) known to consume the compound ==
+
* Gene: [[FISUC_RS02370]]
−
* [[ACETOLACTREDUCTOISOM-RXN]]
+
** Category: [[annotation]]
−
* [[RXN-6081]]
+
*** Source: [[fibrobacter_succinogenes2]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
== Reaction(s) known to produce the compound ==
+
* Gene: [[FSU_RS04260]]
−
* [[ACETOLACTSYN-RXN]]
+
** Category: [[annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Source: [[fibrobacter_succinogenes1]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
−
{{#set: common-name=(s)-2-acetolactate}}
+
** Category: [[orthology]]
−
{{#set: inchi-key=inchikey=nmdwgegfjubklb-yfkpbyrvsa-m}}
+
*** Source: [[ecoli]], Tool: [[orthofinder]], Assignment: n.a, Comment: n.a
−
{{#set: molecular-weight=131.108}}
+
== Pathway(s) ==
 +
== Reconstruction information  ==
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes2]]; tool: [[pathwaytools]]; comment: n.a
 +
* category: [[orthology]]; source: [[ecoli]]; tool: [[orthofinder]]; comment: n.a
 +
* category: [[annotation]]; source: [[fibrobacter_succinogenes1]]; tool: [[pathwaytools]]; comment: n.a
 +
== External links  ==
 +
* RHEA:
 +
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=27763 27763]
 +
* LIGAND-RXN:
 +
** [http://www.genome.jp/dbget-bin/www_bget?R00515 R00515]
 +
{{#set: ec-number=ec-3.6.1.9|ec-3.6.1.65}}
 +
{{#set: direction=left-to-right}}
 +
{{#set: common-name=nucleoside triphosphate pyrophosphohydrolase}}
 +
{{#set: nb gene associated=3}}
 +
{{#set: nb pathway associated=0}}
 +
{{#set: reconstruction category=orthology|annotation}}
 +
{{#set: reconstruction tool=orthofinder|pathwaytools}}
 +
{{#set: reconstruction comment=n.a}}
 +
{{#set: reconstruction source=ecoli|fibrobacter_succinogenes2|fibrobacter_succinogenes1}}

Latest revision as of 11:18, 17 October 2022

Reaction RXN0-383

  • ec-number:
  • direction:
    • left-to-right
  • common-name:
    • nucleoside triphosphate pyrophosphohydrolase

Reaction formula

Gene(s) associated with this reaction

Pathway(s)

Reconstruction information

External links





Retrieved from "http://gem-aureme.genouest.org//fsucgem/index.php?title=RXN0-383&oldid=93194"