Difference between revisions of "HOMO-CYS"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite QUINOLINATE == * common-name: ** quinolinate * inchi-key: ** gjawhxhkyyxbsv-uhfffaoysa-l * molecular-weight: ** 165.105 * smiles: ** c1(/...")
(Created page with "Category:metabolite == Metabolite HOMO-CYS == * common-name: ** l-homocysteine * inchi-key: ** fffhzydwpbmwhy-vkhmyheasa-n * molecular-weight: ** 135.181 * smiles: ** c([c...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite QUINOLINATE ==
+
== Metabolite HOMO-CYS ==
 
* common-name:
 
* common-name:
** quinolinate
+
** l-homocysteine
 
* inchi-key:
 
* inchi-key:
** gjawhxhkyyxbsv-uhfffaoysa-l
+
** fffhzydwpbmwhy-vkhmyheasa-n
 
* molecular-weight:
 
* molecular-weight:
** 165.105
+
** 135.181
 
* smiles:
 
* smiles:
** c1(/n=c(c([o-])=o)c(\c([o-])=o)=c/c=1)
+
** c([c@h](ccs)[n+])(=o)[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[QUINOPRIBOTRANS-RXN]]
+
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[HOMOCYSMETB12-RXN]]
 +
* [[HOMOCYSTEINE-S-METHYLTRANSFERASE-RXN]]
 +
* [[R00946]]
 +
* [[RXN-9384]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[QUINOLINATE-SYNTHA-RXN]]
+
* [[ACETYLHOMOSER-CYS-RXN]]
 +
* [[ADENOSYLHOMOCYSTEINASE-RXN]]
 +
* [[HOMOCYSMET-RXN]]
 +
* [[R00946]]
 +
* [[RIBOSYLHOMOCYSTEINASE-RXN]]
 +
* [[RXN-15131]]
 +
* [[RXN-9384]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=quinolinate}}
+
{{#set: common-name=l-homocysteine}}
{{#set: inchi-key=inchikey=gjawhxhkyyxbsv-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=fffhzydwpbmwhy-vkhmyheasa-n}}
{{#set: molecular-weight=165.105}}
+
{{#set: molecular-weight=135.181}}

Latest revision as of 11:11, 17 October 2022

Metabolite HOMO-CYS

  • common-name:
    • l-homocysteine
  • inchi-key:
    • fffhzydwpbmwhy-vkhmyheasa-n
  • molecular-weight:
    • 135.181
  • smiles:
    • c([c@h](ccs)[n+])(=o)[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality