Difference between revisions of "CPD-7222"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ARGININO-SUCCINATE == * common-name: ** l-arginino-succinate * smiles: ** c(nc(=[n+])nc(cc(=o)[o-])c(=o)[o-])ccc(c(=o)[o-])[n+] * inchi...") |
(Created page with "Category:metabolite == Metabolite THIOCYSTEINE == * common-name: ** thiocysteine * smiles: ** c(ss)c(c([o-])=o)[n+] * inchi-key: ** xbkonscrebsmcs-reohclbhsa-n * molecular...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite THIOCYSTEINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** thiocysteine |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(ss)c(c([o-])=o)[n+] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xbkonscrebsmcs-reohclbhsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 153.214 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[CYSTHIOCYS-RXN]] |
| − | * [[ | + | * [[RXN-15128]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=thiocysteine}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xbkonscrebsmcs-reohclbhsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=153.214}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite THIOCYSTEINE
- common-name:
- thiocysteine
- smiles:
- c(ss)c(c([o-])=o)[n+]
- inchi-key:
- xbkonscrebsmcs-reohclbhsa-n
- molecular-weight:
- 153.214
