Difference between revisions of "CPD-12935"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12121 == * common-name: ** demethylmenaquinol-12 * smiles: ** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=c...")
(Created page with "Category:metabolite == Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate == * common-name: ** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate == Reaction(s) known to con...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12121 ==
+
== Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-12
+
** a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c)c)c)c
 
* inchi-key:
 
** nkcmhmxwladgov-rvhibigxsa-n
 
* molecular-weight:
 
** 977.59
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9363]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-16071]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-12}}
+
{{#set: common-name=a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate}}
{{#set: inchi-key=inchikey=nkcmhmxwladgov-rvhibigxsa-n}}
 
{{#set: molecular-weight=977.59}}
 

Revision as of 18:58, 14 January 2021

Metabolite 1-Alpha-Linolenoyl-L-Phosphatidate

  • common-name:
    • a 1-α-linolenoyl 2-acyl-sn-glycerol 3-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality