Difference between revisions of "CPD-9612"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PROSTAGLANDIN-H2 == * common-name: ** prostaglandin-h2 * smiles: ** cccccc(o)c=cc2(c1(cc(oo1)c(cc=ccccc(=o)[o-])2)) * inchi-key: ** yibnh...") |
(Created page with "Category:metabolite == Metabolite DNA-Ligase-L-lysine-guanylate == * common-name: ** a [dna ligase]-l-lysine-guanylate == Reaction(s) known to consume the compound == * ...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite DNA-Ligase-L-lysine-guanylate == |
* common-name: | * common-name: | ||
− | ** | + | ** a [dna ligase]-l-lysine-guanylate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-17922]] |
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-17921]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [dna ligase]-l-lysine-guanylate}} |
− | |||
− |
Revision as of 18:58, 14 January 2021
Contents
Metabolite DNA-Ligase-L-lysine-guanylate
- common-name:
- a [dna ligase]-l-lysine-guanylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [dna ligase]-l-lysine-guanylate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.