Difference between revisions of "D-Hexoses"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N4-N-ACETYL-BETA-D-GLUCOSAMINYL-F6 == * common-name: ** an n4-{β-d-glcnac-(1→2)-α-d-man-(1→3)-[β-d-glcnac-(1&ra...") |
(Created page with "Category:metabolite == Metabolite PYRIDOXINE-5P == * common-name: ** pyridoxine 5'-phosphate * smiles: ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) * inchi-key: ** whomfkwh...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite PYRIDOXINE-5P == |
* common-name: | * common-name: | ||
− | ** | + | ** pyridoxine 5'-phosphate |
+ | * smiles: | ||
+ | ** cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co) | ||
+ | * inchi-key: | ||
+ | ** whomfkwhiqzthy-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 247.144 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[PNPOXI-RXN]] | ||
+ | * [[RXN-14181]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[PNKIN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=pyridoxine 5'-phosphate}} |
+ | {{#set: inchi-key=inchikey=whomfkwhiqzthy-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=247.144}} |
Revision as of 18:58, 14 January 2021
Contents
Metabolite PYRIDOXINE-5P
- common-name:
- pyridoxine 5'-phosphate
- smiles:
- cc1(=nc=c(cop([o-])(=o)[o-])c(=c(o)1)co)
- inchi-key:
- whomfkwhiqzthy-uhfffaoysa-l
- molecular-weight:
- 247.144